Overslaan naar inhoud

Benzyl-2,3,4,5,6-d5-dimethyltetradecylammonium Bromide50mg

https://www.visualbioinformatics.com/web/image/product.template/34021/image_1920?unique=9304f54
Benzyl-2,3,4,5,6-d5-dimethyltetradecylammonium Bromide (CAS: 1515861-68-3) has the chemical formula CH3(CH2)13N(Br)(CH3)2CH2C6D5 and a molecular weight of 416.28 g/mol It typically appears as white solid with a purity of 99 atom % D and a flash point of nan commonly used in chemical synthesis or laboratory applications.

451,00 € 451.0 EUR 451,00 €

451,00 €

Not Available For Sale

Deze combinatie bestaat niet.

Algemene voorwaarden
30-dagen geld terug garantie
Verzending: 2-3 werkdagen